C28H44N6O — CID 143450305
6-[2-(4-ethyl-3-methylpiperazin-1-yl)ethoxy]-2-N-[(E)-(3-methylphenyl)methylideneamino]-4-N,4-N-dipropylpyridine-2,4-diamine (PubChem CID 143450305) has the molecular formula C28H44N6O and a molecular weight of 480.70 g/mol. Its IUPAC name is 6-[2-(4-ethyl-3-methylpiperazin-1-yl)ethoxy]-2-N-[(E)-(3-methylphenyl)methylideneamino]-4-N,4-N-dipropylpyridine-2,4-diamine.
| Compound Name | 6-[2-(4-ethyl-3-methylpiperazin-1-yl)ethoxy]-2-N-[(E)-(3-methylphenyl)methylideneamino]-4-N,4-N-dipropylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 143450305 |
| Molecular Formula | C28H44N6O |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | 6-[2-(4-ethyl-3-methylpiperazin-1-yl)ethoxy]-2-N-[(E)-(3-methylphenyl)methylideneamino]-4-N,4-N-dipropylpyridine-2,4-diamine |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2cccc(C)c2)nc(OCCN2CCN(CC)C(C)C2)c1 |
| InChI | InChI=1S/C28H44N6O/c1-6-12-34(13-7-2)26-19-27(31-29-21-25-11-9-10-23(4)18-25)30-28(20-26)35-17-16-32-14-15-33(8-3)24(5)22-32/h9-11,18-21,24H,6-8,12-17,22H2,1-5H3,(H,30,31)/b29-21+ |
| InChIKey | PTDGIXRXERULHG-XHLNEMQHSA-N |
| XLogP | 4.87 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|