C26H39N5O2 — CID 89358336
2-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-4-amine (PubChem CID 89358336) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-4-amine.
| Compound Name | 2-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-4-amine |
|---|---|
| PubChem CID | 89358336 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | 2-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-6-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-4-amine |
| SMILES | CCCN(CCC)c1cc(/C=N/Nc2ccc(C)c(C)c2)nc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C26H39N5O2/c1-5-9-31(10-6-2)25-18-24(20-27-29-23-8-7-21(3)22(4)17-23)28-26(19-25)33-16-13-30-11-14-32-15-12-30/h7-8,17-20,29H,5-6,9-16H2,1-4H3/b27-20+ |
| InChIKey | IDIJRTRCSIMOOT-NHFJDJAPSA-N |
| XLogP | 4.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|