C24H33N5O3 — CID 66648014
3,4-dimethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylideneamino]aniline (PubChem CID 66648014) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3,4-dimethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylideneamino]aniline.
| Compound Name | 3,4-dimethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 66648014 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 3,4-dimethyl-N-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylideneamino]aniline |
| SMILES | Cc1ccc(NN=Cc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)cc1C |
| InChI | InChI=1S/C24H33N5O3/c1-19-3-4-21(15-20(19)2)27-25-18-22-16-23(29-8-12-31-13-9-29)17-24(26-22)32-14-7-28-5-10-30-11-6-28/h3-4,15-18,27H,5-14H2,1-2H3 |
| InChIKey | RKWQRKZMNNXLFW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|