C23H32N6O3 — CID 11328144
N-[(E)-(2-amino-5-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine (PubChem CID 11328144) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is N-[(E)-(2-amino-5-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine.
| Compound Name | N-[(E)-(2-amino-5-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 11328144 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-[(E)-(2-amino-5-methylphenyl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
| SMILES | Cc1ccc(N)c(/C=N/Nc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H32N6O3/c1-18-2-3-21(24)19(14-18)17-25-27-22-15-20(29-7-11-31-12-8-29)16-23(26-22)32-13-6-28-4-9-30-10-5-28/h2-3,14-17H,4-13,24H2,1H3,(H,26,27)/b25-17+ |
| InChIKey | RFSNBUITCSGQDM-KOEQRZSOSA-N |
| XLogP | 1.97 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|