C25H32N6O5S — CID 59673876
N-[(E)-(1-methylsulfonylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine (PubChem CID 59673876) has the molecular formula C25H32N6O5S and a molecular weight of 528.64 g/mol. Its IUPAC name is N-[(E)-(1-methylsulfonylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine.
| Compound Name | N-[(E)-(1-methylsulfonylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 59673876 |
| Molecular Formula | C25H32N6O5S |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | N-[(E)-(1-methylsulfonylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)pyridin-2-amine |
| SMILES | CS(=O)(=O)n1cc(/C=N/Nc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)c2ccccc21 |
| InChI | InChI=1S/C25H32N6O5S/c1-37(32,33)31-19-20(22-4-2-3-5-23(22)31)18-26-28-24-16-21(30-9-13-35-14-10-30)17-25(27-24)36-15-8-29-6-11-34-12-7-29/h2-5,16-19H,6-15H2,1H3,(H,27,28)/b26-18+ |
| InChIKey | SLYNPAJEXPAEKZ-NLRVBDNBSA-N |
| XLogP | 1.84 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|