C23H30N6O4 — CID 66682180
3-[2-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylidene]hydrazinyl]benzamide (PubChem CID 66682180) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-[2-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylidene]hydrazinyl]benzamide.
| Compound Name | 3-[2-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylidene]hydrazinyl]benzamide |
|---|---|
| PubChem CID | 66682180 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 3-[2-[[4-morpholin-4-yl-6-(2-morpholin-4-ylethoxy)-2-pyridinyl]methylidene]hydrazinyl]benzamide |
| SMILES | NC(=O)c1cccc(NN=Cc2cc(N3CCOCC3)cc(OCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H30N6O4/c24-23(30)18-2-1-3-19(14-18)27-25-17-20-15-21(29-7-11-32-12-8-29)16-22(26-20)33-13-6-28-4-9-31-10-5-28/h1-3,14-17,27H,4-13H2,(H2,24,30) |
| InChIKey | KYEJMFJXYTXMFT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|