C20H26N6O4 — CID 66648290
3-[2-[[6-(2-hydroxy-2-methylpropoxy)-2-morpholin-4-ylpyrimidin-4-yl]methylidene]hydrazinyl]benzamide (PubChem CID 66648290) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-[2-[[6-(2-hydroxy-2-methylpropoxy)-2-morpholin-4-ylpyrimidin-4-yl]methylidene]hydrazinyl]benzamide.
| Compound Name | 3-[2-[[6-(2-hydroxy-2-methylpropoxy)-2-morpholin-4-ylpyrimidin-4-yl]methylidene]hydrazinyl]benzamide |
|---|---|
| PubChem CID | 66648290 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[2-[[6-(2-hydroxy-2-methylpropoxy)-2-morpholin-4-ylpyrimidin-4-yl]methylidene]hydrazinyl]benzamide |
| SMILES | CC(C)(O)COc1cc(C=NNc2cccc(C(N)=O)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H26N6O4/c1-20(2,28)13-30-17-11-16(23-19(24-17)26-6-8-29-9-7-26)12-22-25-15-5-3-4-14(10-15)18(21)27/h3-5,10-12,25,28H,6-9,13H2,1-2H3,(H2,21,27) |
| InChIKey | YKJMPFXLOCPIHG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|