C18H25N7O2 — CID 11187877
3-methyl-N-[(E)-[4-[2-(methylamino)ethoxy]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methylideneamino]aniline (PubChem CID 11187877) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 3-methyl-N-[(E)-[4-[2-(methylamino)ethoxy]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methylideneamino]aniline.
| Compound Name | 3-methyl-N-[(E)-[4-[2-(methylamino)ethoxy]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 11187877 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-methyl-N-[(E)-[4-[2-(methylamino)ethoxy]-6-morpholin-4-yl-1,3,5-triazin-2-yl]methylideneamino]aniline |
| SMILES | CNCCOc1nc(/C=N/Nc2cccc(C)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N7O2/c1-14-4-3-5-15(12-14)24-20-13-16-21-17(25-7-10-26-11-8-25)23-18(22-16)27-9-6-19-2/h3-5,12-13,19,24H,6-11H2,1-2H3/b20-13+ |
| InChIKey | SRNOOEKZFHLGFX-DEDYPNTBSA-N |
| XLogP | 1.06 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|