C25H25N7O2 — CID 11178549
N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]naphthalen-2-amine (PubChem CID 11178549) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]naphthalen-2-amine.
| Compound Name | N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]naphthalen-2-amine |
|---|---|
| PubChem CID | 11178549 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[(E)-[4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-yl]methylideneamino]naphthalen-2-amine |
| SMILES | C(=N/Nc1ccc2ccccc2c1)\c1nc(OCCc2ccccn2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C25H25N7O2/c1-2-6-20-17-22(9-8-19(20)5-1)31-27-18-23-28-24(32-12-15-33-16-13-32)30-25(29-23)34-14-10-21-7-3-4-11-26-21/h1-9,11,17-18,31H,10,12-16H2/b27-18+ |
| InChIKey | DJXQJGVBLDVQAJ-OVVQPSECSA-N |
| XLogP | 3.32 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|