C23H24Cl2N8O2-2 — CID 135505691
N-[(E)-1H-indol-3-ylmethylideneamino]-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine dichloride (PubChem CID 135505691) has the molecular formula C23H24Cl2N8O2-2 and a molecular weight of 515.41 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine dichloride.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine dichloride |
|---|---|
| PubChem CID | 135505691 |
| Molecular Formula | C23H24Cl2N8O2-2 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-4-morpholin-4-yl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazin-2-amine dichloride |
| SMILES | C(=N/Nc1nc(OCCc2ccccn2)nc(N2CCOCC2)n1)\c1c[nH]c2ccccc12.[Cl-].[Cl-] |
| InChI | InChI=1S/C23H24N8O2.2ClH/c1-2-7-20-19(6-1)17(15-25-20)16-26-30-21-27-22(31-10-13-32-14-11-31)29-23(28-21)33-12-8-18-5-3-4-9-24-18;;/h1-7,9,15-16,25H,8,10-14H2,(H,27,28,29,30);2*1H/p-2/b26-16+;; |
| InChIKey | RVUKSIKCQBRQBA-SZQCDHDFSA-L |
| XLogP | -3.34 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|