C22H21ClN8O — CID 153389188
4-N-(2-chlorophenyl)-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 153389188) has the molecular formula C22H21ClN8O and a molecular weight of 448.92 g/mol. Its IUPAC name is 4-N-(2-chlorophenyl)-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(2-chlorophenyl)-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 153389188 |
| Molecular Formula | C22H21ClN8O |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-N-(2-chlorophenyl)-2-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1ccccc1Nc1nc(N/N=C/c2c[nH]c3ccccc23)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H21ClN8O/c23-17-6-2-4-8-19(17)26-20-27-21(29-22(28-20)31-9-11-32-12-10-31)30-25-14-15-13-24-18-7-3-1-5-16(15)18/h1-8,13-14,24H,9-12H2,(H2,26,27,28,29,30)/b25-14+ |
| InChIKey | RPXUBXBEMXPVMU-AFUMVMLFSA-N |
| XLogP | 4.03 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|