C23H22N8O — CID 11835920
6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 11835920) has the molecular formula C23H22N8O and a molecular weight of 426.48 g/mol. Its IUPAC name is 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11835920 |
| Molecular Formula | C23H22N8O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | C(=N/Nc1nc(Nc2cccc3ccccc23)nc(N2CCOCC2)n1)\c1ccncc1 |
| InChI | InChI=1S/C23H22N8O/c1-2-6-19-18(4-1)5-3-7-20(19)26-21-27-22(30-25-16-17-8-10-24-11-9-17)29-23(28-21)31-12-14-32-15-13-31/h1-11,16H,12-15H2,(H2,26,27,28,29,30)/b25-16+ |
| InChIKey | VFKXVMJBMIQJDP-PCLIKHOPSA-N |
| XLogP | 3.45 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|