C27H27N7O — CID 22303535
6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-[(Z)-3-phenylbut-2-enylidene]amino]-1,3,5-triazine-2,4-diamine (PubChem CID 22303535) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-[(Z)-3-phenylbut-2-enylidene]amino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-[(Z)-3-phenylbut-2-enylidene]amino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22303535 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 6-morpholin-4-yl-4-N-naphthalen-1-yl-2-N-[(E)-[(Z)-3-phenylbut-2-enylidene]amino]-1,3,5-triazine-2,4-diamine |
| SMILES | C/C(=C/C=N/Nc1nc(Nc2cccc3ccccc23)nc(N2CCOCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C27H27N7O/c1-20(21-8-3-2-4-9-21)14-15-28-33-26-30-25(31-27(32-26)34-16-18-35-19-17-34)29-24-13-7-11-22-10-5-6-12-23(22)24/h2-15H,16-19H2,1H3,(H2,29,30,31,32,33)/b20-14-,28-15+ |
| InChIKey | URUVQIBFPCFDSB-WMADTVMISA-N |
| XLogP | 5.11 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|