C25H25N7O3 — CID 3314272
2-methoxy-6-[[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol (PubChem CID 3314272) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-methoxy-6-[[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-6-[[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3314272 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-methoxy-6-[[[4-morpholin-4-yl-6-(naphthalen-1-ylamino)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| SMILES | COc1cccc(C=NNc2nc(Nc3cccc4ccccc34)nc(N3CCOCC3)n2)c1O |
| InChI | InChI=1S/C25H25N7O3/c1-34-21-11-5-8-18(22(21)33)16-26-31-24-28-23(29-25(30-24)32-12-14-35-15-13-32)27-20-10-4-7-17-6-2-3-9-19(17)20/h2-11,16,33H,12-15H2,1H3,(H2,27,28,29,30,31) |
| InChIKey | TUCQAUXZUJANGY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|