C25H22BrN7O3 — CID 171978881
2-N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 171978881) has the molecular formula C25H22BrN7O3 and a molecular weight of 548.40 g/mol. Its IUPAC name is 2-N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 171978881 |
| Molecular Formula | C25H22BrN7O3 |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 2-N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Brc1cc2c(cc1/C=N/Nc1nc(Nc3cccc4ccccc34)nc(N3CCOCC3)n1)OCO2 |
| InChI | InChI=1S/C25H22BrN7O3/c26-19-13-22-21(35-15-36-22)12-17(19)14-27-32-24-29-23(30-25(31-24)33-8-10-34-11-9-33)28-20-7-3-5-16-4-1-2-6-18(16)20/h1-7,12-14H,8-11,15H2,(H2,28,29,30,31,32)/b27-14+ |
| InChIKey | JQUZTRYMKIDLAY-MZJWZYIUSA-N |
| XLogP | 4.54 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|