C23H22N8O5 — CID 169448282
2-N,4-N-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 169448282) has the molecular formula C23H22N8O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is 2-N,4-N-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 169448282 |
| Molecular Formula | C23H22N8O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-N,4-N-bis[(E)-1,3-benzodioxol-5-ylmethylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | C(=N/Nc1nc(N/N=C/c2ccc3c(c2)OCO3)nc(N2CCOCC2)n1)\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H22N8O5/c1-3-17-19(35-13-33-17)9-15(1)11-24-29-21-26-22(28-23(27-21)31-5-7-32-8-6-31)30-25-12-16-2-4-18-20(10-16)36-14-34-18/h1-4,9-12H,5-8,13-14H2,(H2,26,27,28,29,30)/b24-11+,25-12+ |
| InChIKey | DIBOZOBKHMBMKE-DHSUVYDUSA-N |
| XLogP | 2.06 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|