C20H25N7O4 — CID 3135115
N-(1,3-benzodioxol-5-ylmethylideneamino)-N-methyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 3135115) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-N-methyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-N-methyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 3135115 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-N-methyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CN(N=Cc1ccc2c(c1)OCO2)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25N7O4/c1-25(21-13-15-2-3-16-17(12-15)31-14-30-16)18-22-19(26-4-8-28-9-5-26)24-20(23-18)27-6-10-29-11-7-27/h2-3,12-13H,4-11,14H2,1H3 |
| InChIKey | HCPGMEYSYAMBNF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|