C25H36N8O3 — CID 126210067
2-[4-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide (PubChem CID 126210067) has the molecular formula C25H36N8O3 and a molecular weight of 496.62 g/mol. Its IUPAC name is 2-[4-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126210067 |
| Molecular Formula | C25H36N8O3 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 2-[4-[(E)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]-2-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(/C=N/N(C)c2nc(N3CCCCC3)nc(N3CCCCC3)n2)ccc1OCC(N)=O |
| InChI | InChI=1S/C25H36N8O3/c1-3-35-21-16-19(10-11-20(21)36-18-22(26)34)17-27-31(2)23-28-24(32-12-6-4-7-13-32)30-25(29-23)33-14-8-5-9-15-33/h10-11,16-17H,3-9,12-15,18H2,1-2H3,(H2,26,34)/b27-17+ |
| InChIKey | YJBQNZSESTZFQH-WPWMEQJKSA-N |
| XLogP | 2.59 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|