C28H34ClN7O3 — CID 126210907
ethyl 2-chloro-5-[5-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 126210907) has the molecular formula C28H34ClN7O3 and a molecular weight of 552.08 g/mol. Its IUPAC name is ethyl 2-chloro-5-[5-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[5-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126210907 |
| Molecular Formula | C28H34ClN7O3 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | ethyl 2-chloro-5-[5-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2ccc(/C=N\N(C)c3nc(N4CCCCC4)nc(N4CCCCC4)n3)o2)ccc1Cl |
| InChI | InChI=1S/C28H34ClN7O3/c1-3-38-25(37)22-18-20(10-12-23(22)29)24-13-11-21(39-24)19-30-34(2)26-31-27(35-14-6-4-7-15-35)33-28(32-26)36-16-8-5-9-17-36/h10-13,18-19H,3-9,14-17H2,1-2H3/b30-19- |
| InChIKey | JKDPPTMMJJQSNJ-FSGOGVSDSA-N |
| XLogP | 5.41 |
| TPSA | 100.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|