C19H20N2O3 — CID 1276317
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-morpholin-4-ylphenyl)methanimine (PubChem CID 1276317) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-morpholin-4-ylphenyl)methanimine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-morpholin-4-ylphenyl)methanimine |
|---|---|
| PubChem CID | 1276317 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-morpholin-4-ylphenyl)methanimine |
| SMILES | C(=N/c1ccc(N2CCOCC2)cc1)\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H20N2O3/c1-6-18-19(24-12-11-23-18)13-15(1)14-20-16-2-4-17(5-3-16)21-7-9-22-10-8-21/h1-6,13-14H,7-12H2/b20-14+ |
| InChIKey | DNJCFUUHVFQKLW-XSFVSMFZSA-N |
| XLogP | 3.05 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|