C26H24N2O6 — CID 23738973
[2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 23738973) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 23738973 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [2-methoxy-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(/C=N/c2ccc(N3CCOCC3)cc2)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H24N2O6/c1-30-24-14-18(16-27-20-4-6-21(7-5-20)28-10-12-31-13-11-28)2-8-23(24)34-26(29)19-3-9-22-25(15-19)33-17-32-22/h2-9,14-16H,10-13,17H2,1H3/b27-16+ |
| InChIKey | NKSSCNXWBPPGPP-JVWAILMASA-N |
| XLogP | 4.23 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|