C25H25N4O5+ — CID 6961191
[2-methoxy-4-[(4-piperazin-4-ium-1-ylphenyl)iminomethyl]phenyl] 4-nitrobenzoate (PubChem CID 6961191) has the molecular formula C25H25N4O5+ and a molecular weight of 461.50 g/mol. Its IUPAC name is [2-methoxy-4-[(4-piperazin-4-ium-1-ylphenyl)iminomethyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-methoxy-4-[(4-piperazin-4-ium-1-ylphenyl)iminomethyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 6961191 |
| Molecular Formula | C25H25N4O5+ |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-methoxy-4-[(4-piperazin-4-ium-1-ylphenyl)iminomethyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1cc(/C=N/c2ccc(N3CC[NH2+]CC3)cc2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H24N4O5/c1-33-24-16-18(17-27-20-5-9-21(10-6-20)28-14-12-26-13-15-28)2-11-23(24)34-25(30)19-3-7-22(8-4-19)29(31)32/h2-11,16-17,26H,12-15H2,1H3/p+1/b27-17+ |
| InChIKey | CYLJJCQSCYPXDV-WPWMEQJKSA-O |
| XLogP | 2.96 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|