C22H17N3O7 — CID 5073272
1-[4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]phenyl]ethanone (PubChem CID 5073272) has the molecular formula C22H17N3O7 and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-[4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]phenyl]ethanone.
| Compound Name | 1-[4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]phenyl]ethanone |
|---|---|
| PubChem CID | 5073272 |
| Molecular Formula | C22H17N3O7 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-[4-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]phenyl]ethanone |
| SMILES | COc1cc(/C=N/c2ccc(C(C)=O)cc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N3O7/c1-14(26)16-4-6-17(7-5-16)23-13-15-3-9-21(22(11-15)31-2)32-20-10-8-18(24(27)28)12-19(20)25(29)30/h3-13H,1-2H3/b23-13+ |
| InChIKey | ZVVHEEOKUZGKEE-YDZHTSKRSA-N |
| XLogP | 5.26 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|