C24H22FN7O — CID 6075670
2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 6075670) has the molecular formula C24H22FN7O and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6075670 |
| Molecular Formula | C24H22FN7O |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-N-[(Z)-(3-fluorophenyl)methylideneamino]-6-morpholin-4-yl-4-N-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(/C=N\Nc2nc(Nc3ccc4ccccc4c3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C24H22FN7O/c25-20-7-3-4-17(14-20)16-26-31-23-28-22(29-24(30-23)32-10-12-33-13-11-32)27-21-9-8-18-5-1-2-6-19(18)15-21/h1-9,14-16H,10-13H2,(H2,27,28,29,30,31)/b26-16- |
| InChIKey | DTVKSQYFHMIFOS-QQXSKIMKSA-N |
| XLogP | 4.19 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|