C23H20F3N7O2 — CID 143789861
2-N-[(E)-(3-ethynylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 143789861) has the molecular formula C23H20F3N7O2 and a molecular weight of 483.45 g/mol. Its IUPAC name is 2-N-[(E)-(3-ethynylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(E)-(3-ethynylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 143789861 |
| Molecular Formula | C23H20F3N7O2 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-N-[(E)-(3-ethynylphenyl)methylideneamino]-6-morpholin-4-yl-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C#Cc1cccc(/C=N/Nc2nc(Nc3ccc(OC(F)(F)F)cc3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C23H20F3N7O2/c1-2-16-4-3-5-17(14-16)15-27-32-21-29-20(30-22(31-21)33-10-12-34-13-11-33)28-18-6-8-19(9-7-18)35-23(24,25)26/h1,3-9,14-15H,10-13H2,(H2,28,29,30,31,32)/b27-15+ |
| InChIKey | ZVMHMKRGWXIBKZ-JFLMPSFJSA-N |
| XLogP | 3.78 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|