C25H30N8O — CID 136642520
4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 136642520) has the molecular formula C25H30N8O and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 136642520 |
| Molecular Formula | C25H30N8O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-6-(2-pyridin-2-ylethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(N/N=C/c2c[nH]c3ccccc23)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C25H30N8O/c1-3-14-33(15-4-2)24-29-23(30-25(31-24)34-16-12-20-9-7-8-13-26-20)32-28-18-19-17-27-22-11-6-5-10-21(19)22/h5-11,13,17-18,27H,3-4,12,14-16H2,1-2H3,(H,29,30,31,32)/b28-18+ |
| InChIKey | ZLBWLMSIMWWYPK-MTDXEUNCSA-N |
| XLogP | 4.44 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|