C24H29IN6O — CID 143533368
6-N-[(E)-(3-iodophenyl)methylideneamino]-4-N,4-N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidine-4,6-diamine (PubChem CID 143533368) has the molecular formula C24H29IN6O and a molecular weight of 544.44 g/mol. Its IUPAC name is 6-N-[(E)-(3-iodophenyl)methylideneamino]-4-N,4-N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidine-4,6-diamine.
| Compound Name | 6-N-[(E)-(3-iodophenyl)methylideneamino]-4-N,4-N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143533368 |
| Molecular Formula | C24H29IN6O |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 6-N-[(E)-(3-iodophenyl)methylideneamino]-4-N,4-N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2cccc(I)c2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C24H29IN6O/c1-3-13-31(14-4-2)23-17-22(30-27-18-19-8-7-9-20(25)16-19)28-24(29-23)32-15-11-21-10-5-6-12-26-21/h5-10,12,16-18H,3-4,11,13-15H2,1-2H3,(H,28,29,30)/b27-18+ |
| InChIKey | LZEVWBPYEZENKU-OVVQPSECSA-N |
| XLogP | 5.17 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|