C25H31N5O2 — CID 89358533
6-[(E)-(3-methylphenyl)methylideneamino]oxy-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine (PubChem CID 89358533) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 6-[(E)-(3-methylphenyl)methylideneamino]oxy-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine.
| Compound Name | 6-[(E)-(3-methylphenyl)methylideneamino]oxy-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 89358533 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 6-[(E)-(3-methylphenyl)methylideneamino]oxy-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
| SMILES | CCCN(CCC)c1cc(O/N=C/c2cccc(C)c2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C25H31N5O2/c1-4-14-30(15-5-2)23-18-24(32-27-19-21-10-8-9-20(3)17-21)29-25(28-23)31-16-12-22-11-6-7-13-26-22/h6-11,13,17-19H,4-5,12,14-16H2,1-3H3/b27-19+ |
| InChIKey | SCOSJAUFBDUAGG-ZXVVBBHZSA-N |
| XLogP | 4.84 |
| TPSA | 72.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|