C25H32N6O2 — CID 143847127
4-[(2E)-2-[[6-[butyl(propyl)amino]-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]methylidene]hydrazinyl]phenol (PubChem CID 143847127) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[(2E)-2-[[6-[butyl(propyl)amino]-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]methylidene]hydrazinyl]phenol.
| Compound Name | 4-[(2E)-2-[[6-[butyl(propyl)amino]-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]methylidene]hydrazinyl]phenol |
|---|---|
| PubChem CID | 143847127 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 4-[(2E)-2-[[6-[butyl(propyl)amino]-2-(2-pyridin-2-ylethoxy)pyrimidin-4-yl]methylidene]hydrazinyl]phenol |
| SMILES | CCCCN(CCC)c1cc(/C=N/Nc2ccc(O)cc2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C25H32N6O2/c1-3-5-16-31(15-4-2)24-18-22(19-27-30-21-9-11-23(32)12-10-21)28-25(29-24)33-17-13-20-8-6-7-14-26-20/h6-12,14,18-19,30,32H,3-5,13,15-17H2,1-2H3/b27-19+ |
| InChIKey | BIUWVZMPFPIABK-ZXVVBBHZSA-N |
| XLogP | 4.66 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|