C30H44N6O — CID 143340641
2-[2-[ethyl(pentyl)amino]ethoxy]-6-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine (PubChem CID 143340641) has the molecular formula C30H44N6O and a molecular weight of 504.72 g/mol. Its IUPAC name is 2-[2-[ethyl(pentyl)amino]ethoxy]-6-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine.
| Compound Name | 2-[2-[ethyl(pentyl)amino]ethoxy]-6-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143340641 |
| Molecular Formula | C30H44N6O |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | 2-[2-[ethyl(pentyl)amino]ethoxy]-6-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine |
| SMILES | CCCCCN(CC)CCOc1nc(/C=N/Nc2ccc3ccccc3c2)cc(N(CCC)CCC)n1 |
| InChI | InChI=1S/C30H44N6O/c1-5-9-12-19-35(8-4)20-21-37-30-32-28(23-29(33-30)36(17-6-2)18-7-3)24-31-34-27-16-15-25-13-10-11-14-26(25)22-27/h10-11,13-16,22-24,34H,5-9,12,17-21H2,1-4H3/b31-24+ |
| InChIKey | JPUWVXRSAUHDGU-QFMPWRQOSA-N |
| XLogP | 6.59 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|