C24H46N6OS — CID 143340877
6-[(E)-[[(Z)-1-butan-2-ylsulfanylbut-1-enyl]hydrazinylidene]methyl]-2-[2-(methylamino)ethoxy]-N,N-dipropylpyrimidin-4-amine;ethane (PubChem CID 143340877) has the molecular formula C24H46N6OS and a molecular weight of 466.74 g/mol. Its IUPAC name is 6-[(E)-[[(Z)-1-butan-2-ylsulfanylbut-1-enyl]hydrazinylidene]methyl]-2-[2-(methylamino)ethoxy]-N,N-dipropylpyrimidin-4-amine;ethane.
| Compound Name | 6-[(E)-[[(Z)-1-butan-2-ylsulfanylbut-1-enyl]hydrazinylidene]methyl]-2-[2-(methylamino)ethoxy]-N,N-dipropylpyrimidin-4-amine;ethane |
|---|---|
| PubChem CID | 143340877 |
| Molecular Formula | C24H46N6OS |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 6-[(E)-[[(Z)-1-butan-2-ylsulfanylbut-1-enyl]hydrazinylidene]methyl]-2-[2-(methylamino)ethoxy]-N,N-dipropylpyrimidin-4-amine;ethane |
| SMILES | CC.CC/C=C(/N/N=C/c1cc(N(CCC)CCC)nc(OCCNC)n1)SC(C)CC |
| InChI | InChI=1S/C22H40N6OS.C2H6/c1-7-11-21(30-18(5)10-4)27-24-17-19-16-20(28(13-8-2)14-9-3)26-22(25-19)29-15-12-23-6;1-2/h11,16-18,23,27H,7-10,12-15H2,1-6H3;1-2H3/b21-11-,24-17+; |
| InChIKey | LDRMXHMQYDKNNE-KAVDRHFZSA-N |
| XLogP | 5.43 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|