C26H34N6O — CID 89358334
6-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine (PubChem CID 89358334) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 6-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine.
| Compound Name | 6-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 89358334 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 6-[(E)-[(3,4-dimethylphenyl)hydrazinylidene]methyl]-N,N-dipropyl-2-(2-pyridin-2-ylethoxy)pyrimidin-4-amine |
| SMILES | CCCN(CCC)c1cc(/C=N/Nc2ccc(C)c(C)c2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C26H34N6O/c1-5-14-32(15-6-2)25-18-24(19-28-31-23-11-10-20(3)21(4)17-23)29-26(30-25)33-16-12-22-9-7-8-13-27-22/h7-11,13,17-19,31H,5-6,12,14-16H2,1-4H3/b28-19+ |
| InChIKey | IETAABFNHDQNJX-TURZUDJPSA-N |
| XLogP | 5.18 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|