C29H33N5O — CID 143341085
2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropyl-6-(2-pyridin-2-ylethoxy)pyridin-4-amine (PubChem CID 143341085) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is 2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropyl-6-(2-pyridin-2-ylethoxy)pyridin-4-amine.
| Compound Name | 2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropyl-6-(2-pyridin-2-ylethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 143341085 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | 2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropyl-6-(2-pyridin-2-ylethoxy)pyridin-4-amine |
| SMILES | CCCN(CCC)c1cc(/C=N/Nc2ccc3ccccc3c2)nc(OCCc2ccccn2)c1 |
| InChI | InChI=1S/C29H33N5O/c1-3-16-34(17-4-2)28-20-27(32-29(21-28)35-18-14-25-11-7-8-15-30-25)22-31-33-26-13-12-23-9-5-6-10-24(23)19-26/h5-13,15,19-22,33H,3-4,14,16-18H2,1-2H3/b31-22+ |
| InChIKey | BHXXORQXDXLNSP-DFKUXCBWSA-N |
| XLogP | 6.32 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|