C22H38N4O2 — CID 143341149
4-N,4-N-dipropyl-6-(2-pyridin-2-yloxyethoxy)pyridine-2,4-diamine;ethane (PubChem CID 143341149) has the molecular formula C22H38N4O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-6-(2-pyridin-2-yloxyethoxy)pyridine-2,4-diamine;ethane.
| Compound Name | 4-N,4-N-dipropyl-6-(2-pyridin-2-yloxyethoxy)pyridine-2,4-diamine;ethane |
|---|---|
| PubChem CID | 143341149 |
| Molecular Formula | C22H38N4O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 4-N,4-N-dipropyl-6-(2-pyridin-2-yloxyethoxy)pyridine-2,4-diamine;ethane |
| SMILES | CC.CC.CCCN(CCC)c1cc(N)nc(OCCOc2ccccn2)c1 |
| InChI | InChI=1S/C18H26N4O2.2C2H6/c1-3-9-22(10-4-2)15-13-16(19)21-18(14-15)24-12-11-23-17-7-5-6-8-20-17;2*1-2/h5-8,13-14H,3-4,9-12H2,1-2H3,(H2,19,21);2*1-2H3 |
| InChIKey | MIRXGSYVHIWZHJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|