C18H35N3O3 — CID 143846971
ethane;6-[2-(2-methoxyethoxy)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine (PubChem CID 143846971) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is ethane;6-[2-(2-methoxyethoxy)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine.
| Compound Name | ethane;6-[2-(2-methoxyethoxy)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 143846971 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | ethane;6-[2-(2-methoxyethoxy)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine |
| SMILES | CC.CCCN(CCC)c1cc(N)nc(OCCOCCOC)c1 |
| InChI | InChI=1S/C16H29N3O3.C2H6/c1-4-6-19(7-5-2)14-12-15(17)18-16(13-14)22-11-10-21-9-8-20-3;1-2/h12-13H,4-11H2,1-3H3,(H2,17,18);1-2H3 |
| InChIKey | ZERKIJCXOJPADP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|