C21H31N3O3 — CID 143450233
6-[2-(3,4-dimethoxyphenyl)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine (PubChem CID 143450233) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 143450233 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine |
| SMILES | CCCN(CCC)c1cc(N)nc(OCCc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H31N3O3/c1-5-10-24(11-6-2)17-14-20(22)23-21(15-17)27-12-9-16-7-8-18(25-3)19(13-16)26-4/h7-8,13-15H,5-6,9-12H2,1-4H3,(H2,22,23) |
| InChIKey | WFQGOEPLKUQADJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |