C21H31N3O2 — CID 10642093
4-[2-[2-(3,4-dimethoxyphenyl)ethyl-propylamino]ethyl]benzene-1,2-diamine (PubChem CID 10642093) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-[2-[2-(3,4-dimethoxyphenyl)ethyl-propylamino]ethyl]benzene-1,2-diamine.
| Compound Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethyl-propylamino]ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 10642093 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 4-[2-[2-(3,4-dimethoxyphenyl)ethyl-propylamino]ethyl]benzene-1,2-diamine |
| SMILES | CCCN(CCc1ccc(N)c(N)c1)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H31N3O2/c1-4-11-24(12-9-16-5-7-18(22)19(23)14-16)13-10-17-6-8-20(25-2)21(15-17)26-3/h5-8,14-15H,4,9-13,22-23H2,1-3H3 |
| InChIKey | MXCZDMLNGYYQOL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|