C14H24N2O2 — CID 54380711
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1-propylhydrazine (PubChem CID 54380711) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1-propylhydrazine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1-propylhydrazine |
|---|---|
| PubChem CID | 54380711 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-methyl-1-propylhydrazine |
| SMILES | CCCN(CCc1ccc(OC)c(OC)c1)NC |
| InChI | InChI=1S/C14H24N2O2/c1-5-9-16(15-2)10-8-12-6-7-13(17-3)14(11-12)18-4/h6-7,11,15H,5,8-10H2,1-4H3 |
| InChIKey | UZRUOPAFQGILDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|