C23H43NO2Si — CID 135049124
2-(3,4-dimethoxyphenyl)-N-methyl-N-tributylsilylethanamine (PubChem CID 135049124) has the molecular formula C23H43NO2Si and a molecular weight of 393.69 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-methyl-N-tributylsilylethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-methyl-N-tributylsilylethanamine |
|---|---|
| PubChem CID | 135049124 |
| Molecular Formula | C23H43NO2Si |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-methyl-N-tributylsilylethanamine |
| SMILES | CCCC[Si](CCCC)(CCCC)N(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H43NO2Si/c1-7-10-17-27(18-11-8-2,19-12-9-3)24(4)16-15-21-13-14-22(25-5)23(20-21)26-6/h13-14,20H,7-12,15-19H2,1-6H3 |
| InChIKey | GXOAPTVWSFZHIK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|