C18H24N2O2 — CID 10447541
4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]aniline (PubChem CID 10447541) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]aniline.
| Compound Name | 4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]aniline |
|---|---|
| PubChem CID | 10447541 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]aniline |
| SMILES | COc1ccc(CN(C)CCc2ccc(N)cc2)cc1OC |
| InChI | InChI=1S/C18H24N2O2/c1-20(11-10-14-4-7-16(19)8-5-14)13-15-6-9-17(21-2)18(12-15)22-3/h4-9,12H,10-11,13,19H2,1-3H3 |
| InChIKey | VEIZXVORFNYOEM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|