C20H28N2O2 — CID 54036285
2-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]aniline (PubChem CID 54036285) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]aniline.
| Compound Name | 2-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]aniline |
|---|---|
| PubChem CID | 54036285 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 2-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]aniline |
| SMILES | COc1ccc(CN(C)CCCCc2ccccc2N)cc1OC |
| InChI | InChI=1S/C20H28N2O2/c1-22(13-7-6-9-17-8-4-5-10-18(17)21)15-16-11-12-19(23-2)20(14-16)24-3/h4-5,8,10-12,14H,6-7,9,13,15,21H2,1-3H3 |
| InChIKey | LJEJYAXPUWDZDQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|