C21H40N4O — CID 143846965
6-[2-(cyclohexylamino)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane (PubChem CID 143846965) has the molecular formula C21H40N4O and a molecular weight of 364.58 g/mol. Its IUPAC name is 6-[2-(cyclohexylamino)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane.
| Compound Name | 6-[2-(cyclohexylamino)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane |
|---|---|
| PubChem CID | 143846965 |
| Molecular Formula | C21H40N4O |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.32 |
| IUPAC Name | 6-[2-(cyclohexylamino)ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane |
| SMILES | CC.CCCN(CCC)c1cc(N)nc(OCCNC2CCCCC2)c1 |
| InChI | InChI=1S/C19H34N4O.C2H6/c1-3-11-23(12-4-2)17-14-18(20)22-19(15-17)24-13-10-21-16-8-6-5-7-9-16;1-2/h14-16,21H,3-13H2,1-2H3,(H2,20,22);1-2H3 |
| InChIKey | JNDLZQITINTTGS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|