C13H23N3O — CID 143340794
6-ethoxy-4-N,4-N-dipropylpyridine-2,4-diamine (PubChem CID 143340794) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 6-ethoxy-4-N,4-N-dipropylpyridine-2,4-diamine.
| Compound Name | 6-ethoxy-4-N,4-N-dipropylpyridine-2,4-diamine |
|---|---|
| PubChem CID | 143340794 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 6-ethoxy-4-N,4-N-dipropylpyridine-2,4-diamine |
| SMILES | CCCN(CCC)c1cc(N)nc(OCC)c1 |
| InChI | InChI=1S/C13H23N3O/c1-4-7-16(8-5-2)11-9-12(14)15-13(10-11)17-6-3/h9-10H,4-8H2,1-3H3,(H2,14,15) |
| InChIKey | MWLGFRWDYJUFDN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |