C17H26N4O3 — CID 143341116
1-[2-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]ethyl]pyrrolidine-2,5-dione (PubChem CID 143341116) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[2-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143341116 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[2-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]ethyl]pyrrolidine-2,5-dione |
| SMILES | CCCN(CCC)c1cc(N)nc(OCCN2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C17H26N4O3/c1-3-7-20(8-4-2)13-11-14(18)19-15(12-13)24-10-9-21-16(22)5-6-17(21)23/h11-12H,3-10H2,1-2H3,(H2,18,19) |
| InChIKey | INDUDLRGIVJDRW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|