C23H46N4O2 — CID 143847042
2-[5-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]pent-1-en-2-ylamino]ethanol;ethane;propane (PubChem CID 143847042) has the molecular formula C23H46N4O2 and a molecular weight of 410.65 g/mol. Its IUPAC name is 2-[5-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]pent-1-en-2-ylamino]ethanol;ethane;propane.
| Compound Name | 2-[5-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]pent-1-en-2-ylamino]ethanol;ethane;propane |
|---|---|
| PubChem CID | 143847042 |
| Molecular Formula | C23H46N4O2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | 2-[5-[[6-amino-4-(dipropylamino)-2-pyridinyl]oxy]pent-1-en-2-ylamino]ethanol;ethane;propane |
| SMILES | C=C(CCCOc1cc(N(CCC)CCC)cc(N)n1)NCCO.CC.CCC |
| InChI | InChI=1S/C18H32N4O2.C3H8.C2H6/c1-4-9-22(10-5-2)16-13-17(19)21-18(14-16)24-12-6-7-15(3)20-8-11-23;1-3-2;1-2/h13-14,20,23H,3-12H2,1-2H3,(H2,19,21);3H2,1-2H3;1-2H3 |
| InChIKey | OAWMMYHIXMPCIV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|