C28H40ClN5O2 — CID 143341441
6-[2-[(5-chloro-2-pyridinyl)oxy]ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine (PubChem CID 143341441) has the molecular formula C28H40ClN5O2 and a molecular weight of 514.11 g/mol. Its IUPAC name is 6-[2-[(5-chloro-2-pyridinyl)oxy]ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine.
| Compound Name | 6-[2-[(5-chloro-2-pyridinyl)oxy]ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 143341441 |
| Molecular Formula | C28H40ClN5O2 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 6-[2-[(5-chloro-2-pyridinyl)oxy]ethoxy]-4-N,4-N-dipropylpyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
| SMILES | CC.CCCN(CCC)c1cc(N)nc(OCCOc2ccc(Cl)cn2)c1.[H]/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C18H25ClN4O2.C8H9N.C2H6/c1-3-7-23(8-4-2)15-11-16(20)22-18(12-15)25-10-9-24-17-6-5-14(19)13-21-17;1-7-3-2-4-8(5-7)6-9;1-2/h5-6,11-13H,3-4,7-10H2,1-2H3,(H2,20,22);2-6,9H,1H3;1-2H3/b;9-6+; |
| InChIKey | UCVYTVNXDRSAGH-YJXWIHHLSA-N |
| XLogP | 6.82 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|