C26H39N5OS — CID 143340727
4-N,4-N-dipropyl-6-[2-(1,3-thiazol-2-yl)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine (PubChem CID 143340727) has the molecular formula C26H39N5OS and a molecular weight of 469.70 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-6-[2-(1,3-thiazol-2-yl)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine.
| Compound Name | 4-N,4-N-dipropyl-6-[2-(1,3-thiazol-2-yl)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 143340727 |
| Molecular Formula | C26H39N5OS |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 4-N,4-N-dipropyl-6-[2-(1,3-thiazol-2-yl)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
| SMILES | CC.CCCN(CCC)c1cc(N)nc(OCCc2nccs2)c1.[H]/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C16H24N4OS.C8H9N.C2H6/c1-3-7-20(8-4-2)13-11-14(17)19-15(12-13)21-9-5-16-18-6-10-22-16;1-7-3-2-4-8(5-7)6-9;1-2/h6,10-12H,3-5,7-9H2,1-2H3,(H2,17,19);2-6,9H,1H3;1-2H3/b;9-6+; |
| InChIKey | YZKYYANPWPSAGW-YJXWIHHLSA-N |
| XLogP | 6.39 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|