C28H42N6O — CID 143450334
4-N,4-N-dipropyl-6-[2-(pyridin-2-ylamino)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine (PubChem CID 143450334) has the molecular formula C28H42N6O and a molecular weight of 478.69 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-6-[2-(pyridin-2-ylamino)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine.
| Compound Name | 4-N,4-N-dipropyl-6-[2-(pyridin-2-ylamino)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
|---|---|
| PubChem CID | 143450334 |
| Molecular Formula | C28H42N6O |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | 4-N,4-N-dipropyl-6-[2-(pyridin-2-ylamino)ethoxy]pyridine-2,4-diamine;ethane;(3-methylphenyl)methanimine |
| SMILES | CC.CCCN(CCC)c1cc(N)nc(OCCNc2ccccn2)c1.[H]/N=C/c1cccc(C)c1 |
| InChI | InChI=1S/C18H27N5O.C8H9N.C2H6/c1-3-10-23(11-4-2)15-13-16(19)22-18(14-15)24-12-9-21-17-7-5-6-8-20-17;1-7-3-2-4-8(5-7)6-9;1-2/h5-8,13-14H,3-4,9-12H2,1-2H3,(H2,19,22)(H,20,21);2-6,9H,1H3;1-2H3/b;9-6+; |
| InChIKey | HGLSEWPTVVDTII-YJXWIHHLSA-N |
| XLogP | 6.19 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|