C29H42N6O2 — CID 143533554
ethane;6-(2-morpholin-4-ylethoxy)-2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine (PubChem CID 143533554) has the molecular formula C29H42N6O2 and a molecular weight of 506.70 g/mol. Its IUPAC name is ethane;6-(2-morpholin-4-ylethoxy)-2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine.
| Compound Name | ethane;6-(2-morpholin-4-ylethoxy)-2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143533554 |
| Molecular Formula | C29H42N6O2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | ethane;6-(2-morpholin-4-ylethoxy)-2-[(E)-(naphthalen-2-ylhydrazinylidene)methyl]-N,N-dipropylpyrimidin-4-amine |
| SMILES | CC.CCCN(CCC)c1cc(OCCN2CCOCC2)nc(/C=N/Nc2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C27H36N6O2.C2H6/c1-3-11-33(12-4-2)26-20-27(35-18-15-32-13-16-34-17-14-32)30-25(29-26)21-28-31-24-10-9-22-7-5-6-8-23(22)19-24;1-2/h5-10,19-21,31H,3-4,11-18H2,1-2H3;1-2H3/b28-21+; |
| InChIKey | XUXSLTANPJNOIX-HUPDFLJJSA-N |
| XLogP | 5.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|