C28H44N6O2 — CID 143333390
ethane;6-N-[(Z)-(3-methyl-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 143333390) has the molecular formula C28H44N6O2 and a molecular weight of 496.70 g/mol. Its IUPAC name is ethane;6-N-[(Z)-(3-methyl-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | ethane;6-N-[(Z)-(3-methyl-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143333390 |
| Molecular Formula | C28H44N6O2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | ethane;6-N-[(Z)-(3-methyl-2,3-dihydroinden-1-ylidene)amino]-2-(2-morpholin-4-ylethoxy)-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CC.CCCN(CCC)c1cc(N/N=C2/CC(C)c3ccccc32)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C26H38N6O2.C2H6/c1-4-10-32(11-5-2)25-19-24(27-26(28-25)34-17-14-31-12-15-33-16-13-31)30-29-23-18-20(3)21-8-6-7-9-22(21)23;1-2/h6-9,19-20H,4-5,10-18H2,1-3H3,(H,27,28,30);1-2H3/b29-23-; |
| InChIKey | DDZQMIAZLDEIOC-MBANDDHJSA-N |
| XLogP | 5.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|